C28H28N2O2 — CID 30693866
N-[(2S)-4-oxo-4-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methylamino]butan-2-yl]benzamide (PubChem CID 30693866) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is N-[(2S)-4-oxo-4-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methylamino]butan-2-yl]benzamide.
| Compound Name | N-[(2S)-4-oxo-4-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methylamino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 30693866 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | N-[(2S)-4-oxo-4-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methylamino]butan-2-yl]benzamide |
| SMILES | C[C@@H](CC(=O)NC[C@@H]1CC2c3ccccc3C1c1ccccc12)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H28N2O2/c1-18(30-28(32)19-9-3-2-4-10-19)15-26(31)29-17-20-16-25-21-11-5-7-13-23(21)27(20)24-14-8-6-12-22(24)25/h2-14,18,20,25,27H,15-17H2,1H3,(H,29,31)(H,30,32)/t18-,20-,25?,27?/m0/s1 |
| InChIKey | UTFFNRLGBKWHMU-RARWEQBVSA-N |
| XLogP | 4.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |