C27H26ClN3O2 — CID 31826214
(3R)-3-(carbamoylamino)-3-(2-chlorophenyl)-N-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]propanamide (PubChem CID 31826214) has the molecular formula C27H26ClN3O2 and a molecular weight of 459.98 g/mol. Its IUPAC name is (3R)-3-(carbamoylamino)-3-(2-chlorophenyl)-N-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]propanamide.
| Compound Name | (3R)-3-(carbamoylamino)-3-(2-chlorophenyl)-N-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]propanamide |
|---|---|
| PubChem CID | 31826214 |
| Molecular Formula | C27H26ClN3O2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (3R)-3-(carbamoylamino)-3-(2-chlorophenyl)-N-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]propanamide |
| SMILES | NC(=O)N[C@H](CC(=O)NC[C@H]1CC2c3ccccc3C1c1ccccc12)c1ccccc1Cl |
| InChI | InChI=1S/C27H26ClN3O2/c28-23-12-6-5-11-21(23)24(31-27(29)33)14-25(32)30-15-16-13-22-17-7-1-3-9-19(17)26(16)20-10-4-2-8-18(20)22/h1-12,16,22,24,26H,13-15H2,(H,30,32)(H3,29,31,33)/t16-,22?,24-,26?/m1/s1 |
| InChIKey | ONEHJGJIUROSSV-KYGYWACYSA-N |
| XLogP | 4.85 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |