C17H19ClN4O4 — CID 42943329
N-[2-[[3-(carbamoylamino)-3-(2-chlorophenyl)propanoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 42943329) has the molecular formula C17H19ClN4O4 and a molecular weight of 378.82 g/mol. Its IUPAC name is N-[2-[[3-(carbamoylamino)-3-(2-chlorophenyl)propanoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[3-(carbamoylamino)-3-(2-chlorophenyl)propanoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42943329 |
| Molecular Formula | C17H19ClN4O4 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | N-[2-[[3-(carbamoylamino)-3-(2-chlorophenyl)propanoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | NC(=O)NC(CC(=O)NCCNC(=O)c1ccco1)c1ccccc1Cl |
| InChI | InChI=1S/C17H19ClN4O4/c18-12-5-2-1-4-11(12)13(22-17(19)25)10-15(23)20-7-8-21-16(24)14-6-3-9-26-14/h1-6,9,13H,7-8,10H2,(H,20,23)(H,21,24)(H3,19,22,25) |
| InChIKey | NSECETQGVSDJIT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|