C25H23NO3S — CID 25496478
4-methylsulfonyl-N-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]benzamide (PubChem CID 25496478) has the molecular formula C25H23NO3S and a molecular weight of 417.53 g/mol. Its IUPAC name is 4-methylsulfonyl-N-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]benzamide.
| Compound Name | 4-methylsulfonyl-N-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]benzamide |
|---|---|
| PubChem CID | 25496478 |
| Molecular Formula | C25H23NO3S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 4-methylsulfonyl-N-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NC[C@@H]2CC3c4ccccc4C2c2ccccc23)cc1 |
| InChI | InChI=1S/C25H23NO3S/c1-30(28,29)18-12-10-16(11-13-18)25(27)26-15-17-14-23-19-6-2-4-8-21(19)24(17)22-9-5-3-7-20(22)23/h2-13,17,23-24H,14-15H2,1H3,(H,26,27)/t17-,23?,24?/m0/s1 |
| InChIKey | HWJTXBJSILPCIN-XWFFHEKESA-N |
| XLogP | 4.12 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |