C26H25N3O4S — CID 166185052
1-[(3-methylsulfonylbenzoyl)amino]-3-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)urea (PubChem CID 166185052) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is 1-[(3-methylsulfonylbenzoyl)amino]-3-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)urea.
| Compound Name | 1-[(3-methylsulfonylbenzoyl)amino]-3-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)urea |
|---|---|
| PubChem CID | 166185052 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 1-[(3-methylsulfonylbenzoyl)amino]-3-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)urea |
| SMILES | CS(=O)(=O)c1cccc(C(=O)NNC(=O)NCC2CC3c4ccccc4C2c2ccccc23)c1 |
| InChI | InChI=1S/C26H25N3O4S/c1-34(32,33)18-8-6-7-16(13-18)25(30)28-29-26(31)27-15-17-14-23-19-9-2-4-11-21(19)24(17)22-12-5-3-10-20(22)23/h2-13,17,23-24H,14-15H2,1H3,(H,28,30)(H2,27,29,31) |
| InChIKey | YACJUXXKYRLICE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|