C22H25N3O6S — CID 166340557
1-[(3-methylsulfonylbenzoyl)amino]-3-spiro[3,4-dihydrochromene-2,4'-oxane]-4-ylurea (PubChem CID 166340557) has the molecular formula C22H25N3O6S and a molecular weight of 459.52 g/mol. Its IUPAC name is 1-[(3-methylsulfonylbenzoyl)amino]-3-spiro[3,4-dihydrochromene-2,4'-oxane]-4-ylurea.
| Compound Name | 1-[(3-methylsulfonylbenzoyl)amino]-3-spiro[3,4-dihydrochromene-2,4'-oxane]-4-ylurea |
|---|---|
| PubChem CID | 166340557 |
| Molecular Formula | C22H25N3O6S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 1-[(3-methylsulfonylbenzoyl)amino]-3-spiro[3,4-dihydrochromene-2,4'-oxane]-4-ylurea |
| SMILES | CS(=O)(=O)c1cccc(C(=O)NNC(=O)NC2CC3(CCOCC3)Oc3ccccc32)c1 |
| InChI | InChI=1S/C22H25N3O6S/c1-32(28,29)16-6-4-5-15(13-16)20(26)24-25-21(27)23-18-14-22(9-11-30-12-10-22)31-19-8-3-2-7-17(18)19/h2-8,13,18H,9-12,14H2,1H3,(H,24,26)(H2,23,25,27) |
| InChIKey | SPPLFQQXTCQZFS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|