C22H28N2O4S — CID 100624225
N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]-3-(dimethylsulfamoyl)benzamide (PubChem CID 100624225) has the molecular formula C22H28N2O4S and a molecular weight of 416.54 g/mol. Its IUPAC name is N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]-3-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]-3-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 100624225 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]-3-(dimethylsulfamoyl)benzamide |
| SMILES | CCC1(CC)C[C@@H](NC(=O)c2cccc(S(=O)(=O)N(C)C)c2)c2ccccc2O1 |
| InChI | InChI=1S/C22H28N2O4S/c1-5-22(6-2)15-19(18-12-7-8-13-20(18)28-22)23-21(25)16-10-9-11-17(14-16)29(26,27)24(3)4/h7-14,19H,5-6,15H2,1-4H3,(H,23,25)/t19-/m1/s1 |
| InChIKey | ITJNRFSWSGOEGJ-LJQANCHMSA-N |
| XLogP | 3.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |