C17H18O4S — CID 171982319
2-[(2-hydroxy-6-oxocyclohexen-1-yl)-thiophen-2-ylmethyl]cyclohexane-1,3-dione (PubChem CID 171982319) has the molecular formula C17H18O4S and a molecular weight of 318.39 g/mol. Its IUPAC name is 2-[(2-hydroxy-6-oxocyclohexen-1-yl)-thiophen-2-ylmethyl]cyclohexane-1,3-dione.
| Compound Name | 2-[(2-hydroxy-6-oxocyclohexen-1-yl)-thiophen-2-ylmethyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 171982319 |
| Molecular Formula | C17H18O4S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-[(2-hydroxy-6-oxocyclohexen-1-yl)-thiophen-2-ylmethyl]cyclohexane-1,3-dione |
| SMILES | O=C1CCCC(O)=C1C(c1cccs1)C1C(=O)CCCC1=O |
| InChI | InChI=1S/C17H18O4S/c18-10-4-1-5-11(19)15(10)17(14-8-3-9-22-14)16-12(20)6-2-7-13(16)21/h3,8-9,15,17,20H,1-2,4-7H2 |
| InChIKey | MDKRTVZSPXBHQK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|