C36H38N2O6 — CID 18604372
(3R)-3-[[(2S)-2-[[1-oxo-1-(2-phenoxyethoxy)-3-phenylpropan-2-yl]amino]-3-(4-phenylphenyl)propanoyl]amino]butanoic acid (PubChem CID 18604372) has the molecular formula C36H38N2O6 and a molecular weight of 594.71 g/mol. Its IUPAC name is (3R)-3-[[(2S)-2-[[1-oxo-1-(2-phenoxyethoxy)-3-phenylpropan-2-yl]amino]-3-(4-phenylphenyl)propanoyl]amino]butanoic acid.
| Compound Name | (3R)-3-[[(2S)-2-[[1-oxo-1-(2-phenoxyethoxy)-3-phenylpropan-2-yl]amino]-3-(4-phenylphenyl)propanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 18604372 |
| Molecular Formula | C36H38N2O6 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | (3R)-3-[[(2S)-2-[[1-oxo-1-(2-phenoxyethoxy)-3-phenylpropan-2-yl]amino]-3-(4-phenylphenyl)propanoyl]amino]butanoic acid |
| SMILES | C[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccc(-c2ccccc2)cc1)NC(Cc1ccccc1)C(=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C36H38N2O6/c1-26(23-34(39)40)37-35(41)32(24-28-17-19-30(20-18-28)29-13-7-3-8-14-29)38-33(25-27-11-5-2-6-12-27)36(42)44-22-21-43-31-15-9-4-10-16-31/h2-20,26,32-33,38H,21-25H2,1H3,(H,37,41)(H,39,40)/t26-,32+,33?/m1/s1 |
| InChIKey | PRQOMLRAXNVPHR-FTBGWDSVSA-N |
| XLogP | 5.07 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|