C22H33NO — CID 18605270
3-(4-butoxyphenyl)-2-(4-propylcyclohexyl)propanenitrile (PubChem CID 18605270) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-2-(4-propylcyclohexyl)propanenitrile.
| Compound Name | 3-(4-butoxyphenyl)-2-(4-propylcyclohexyl)propanenitrile |
|---|---|
| PubChem CID | 18605270 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | 3-(4-butoxyphenyl)-2-(4-propylcyclohexyl)propanenitrile |
| SMILES | CCCCOc1ccc(CC(C#N)C2CCC(CCC)CC2)cc1 |
| InChI | InChI=1S/C22H33NO/c1-3-5-15-24-22-13-9-19(10-14-22)16-21(17-23)20-11-7-18(6-4-2)8-12-20/h9-10,13-14,18,20-21H,3-8,11-12,15-16H2,1-2H3 |
| InChIKey | QWPXNBQJIUYZHO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|