C8H17NO3 — CID 18611240
[(2R,4S)-3-amino-4-hydroxy-3-methylpentan-2-yl] acetate (PubChem CID 18611240) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is [(2R,4S)-3-amino-4-hydroxy-3-methylpentan-2-yl] acetate.
| Compound Name | [(2R,4S)-3-amino-4-hydroxy-3-methylpentan-2-yl] acetate |
|---|---|
| PubChem CID | 18611240 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | [(2R,4S)-3-amino-4-hydroxy-3-methylpentan-2-yl] acetate |
| SMILES | CC(=O)O[C@H](C)C(C)(N)[C@H](C)O |
| InChI | InChI=1S/C8H17NO3/c1-5(10)8(4,9)6(2)12-7(3)11/h5-6,10H,9H2,1-4H3/t5-,6+,8?/m0/s1 |
| InChIKey | IJCZYJSASMLGSE-FWHJPCMOSA-N |
| XLogP | 0.04 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |