C18H18N2O4S — CID 18612448
3-pyridin-3-ylpropyl 1-(2-oxo-2-thiophen-2-ylacetyl)azetidine-2-carboxylate (PubChem CID 18612448) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 1-(2-oxo-2-thiophen-2-ylacetyl)azetidine-2-carboxylate.
| Compound Name | 3-pyridin-3-ylpropyl 1-(2-oxo-2-thiophen-2-ylacetyl)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 18612448 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-pyridin-3-ylpropyl 1-(2-oxo-2-thiophen-2-ylacetyl)azetidine-2-carboxylate |
| SMILES | O=C(C(=O)N1CCC1C(=O)OCCCc1cccnc1)c1cccs1 |
| InChI | InChI=1S/C18H18N2O4S/c21-16(15-6-3-11-25-15)17(22)20-9-7-14(20)18(23)24-10-2-5-13-4-1-8-19-12-13/h1,3-4,6,8,11-12,14H,2,5,7,9-10H2 |
| InChIKey | GQDKSCMFXWDZLR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|