C11H18O4Si — CID 18616533
4-hydroxy-4-(2-trimethylsilylethynyl)oxane-2-carboxylic acid (PubChem CID 18616533) has the molecular formula C11H18O4Si and a molecular weight of 242.35 g/mol. Its IUPAC name is 4-hydroxy-4-(2-trimethylsilylethynyl)oxane-2-carboxylic acid.
| Compound Name | 4-hydroxy-4-(2-trimethylsilylethynyl)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 18616533 |
| Molecular Formula | C11H18O4Si |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 4-hydroxy-4-(2-trimethylsilylethynyl)oxane-2-carboxylic acid |
| SMILES | C[Si](C)(C)C#CC1(O)CCOC(C(=O)O)C1 |
| InChI | InChI=1S/C11H18O4Si/c1-16(2,3)7-5-11(14)4-6-15-9(8-11)10(12)13/h9,14H,4,6,8H2,1-3H3,(H,12,13) |
| InChIKey | GRMBMGDNARADGP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|