C13H26O4Si — CID 11043993
(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloxane-2-carboxylic acid (PubChem CID 11043993) has the molecular formula C13H26O4Si and a molecular weight of 274.43 g/mol. Its IUPAC name is (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloxane-2-carboxylic acid.
| Compound Name | (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 11043993 |
| Molecular Formula | C13H26O4Si |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloxane-2-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCO[C@]1(C)C(=O)O |
| InChI | InChI=1S/C13H26O4Si/c1-12(2,3)18(5,6)17-10-8-7-9-16-13(10,4)11(14)15/h10H,7-9H2,1-6H3,(H,14,15)/t10-,13-/m0/s1 |
| InChIKey | LGRVWMATRFLEKJ-GWCFXTLKSA-N |
| XLogP | 3.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|