C19H25F3N2O3S — CID 18617283
N-[4-nonyl-3-(trifluoromethyl)-1,2-oxazol-5-yl]benzenesulfonamide (PubChem CID 18617283) has the molecular formula C19H25F3N2O3S and a molecular weight of 418.48 g/mol. Its IUPAC name is N-[4-nonyl-3-(trifluoromethyl)-1,2-oxazol-5-yl]benzenesulfonamide.
| Compound Name | N-[4-nonyl-3-(trifluoromethyl)-1,2-oxazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 18617283 |
| Molecular Formula | C19H25F3N2O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[4-nonyl-3-(trifluoromethyl)-1,2-oxazol-5-yl]benzenesulfonamide |
| SMILES | CCCCCCCCCc1c(C(F)(F)F)noc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H25F3N2O3S/c1-2-3-4-5-6-7-11-14-16-17(19(20,21)22)23-27-18(16)24-28(25,26)15-12-9-8-10-13-15/h8-10,12-13,24H,2-7,11,14H2,1H3 |
| InChIKey | QUAIUPABTNKOHM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|