C16H16N2O5S3 — CID 18618498
4-[(4-sulfanyl-1-thiophen-2-ylsulfonylpyrrolidine-2-carbonyl)amino]benzoic acid (PubChem CID 18618498) has the molecular formula C16H16N2O5S3 and a molecular weight of 412.51 g/mol. Its IUPAC name is 4-[(4-sulfanyl-1-thiophen-2-ylsulfonylpyrrolidine-2-carbonyl)amino]benzoic acid.
| Compound Name | 4-[(4-sulfanyl-1-thiophen-2-ylsulfonylpyrrolidine-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 18618498 |
| Molecular Formula | C16H16N2O5S3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 4-[(4-sulfanyl-1-thiophen-2-ylsulfonylpyrrolidine-2-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)C2CC(S)CN2S(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C16H16N2O5S3/c19-15(17-11-5-3-10(4-6-11)16(20)21)13-8-12(24)9-18(13)26(22,23)14-2-1-7-25-14/h1-7,12-13,24H,8-9H2,(H,17,19)(H,20,21) |
| InChIKey | KSRRLIZNROSLOH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|