C5H5F2N — CID 18619801
2,3-difluoro-1,2-dihydropyridine (PubChem CID 18619801) has the molecular formula C5H5F2N and a molecular weight of 117.10 g/mol. Its IUPAC name is 2,3-difluoro-1,2-dihydropyridine.
| Compound Name | 2,3-difluoro-1,2-dihydropyridine |
|---|---|
| PubChem CID | 18619801 |
| Molecular Formula | C5H5F2N |
| Molecular Weight | 117.10 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | 2,3-difluoro-1,2-dihydropyridine |
| SMILES | FC1=CC=CNC1F |
| InChI | InChI=1S/C5H5F2N/c6-4-2-1-3-8-5(4)7/h1-3,5,8H |
| InChIKey | SPFLVGKCINSPOW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.10 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|