C5H3F4N — CID 18367515
2,3,5,6-tetrafluoro-1,2-dihydropyridine (PubChem CID 18367515) has the molecular formula C5H3F4N and a molecular weight of 153.08 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-1,2-dihydropyridine.
| Compound Name | 2,3,5,6-tetrafluoro-1,2-dihydropyridine |
|---|---|
| PubChem CID | 18367515 |
| Molecular Formula | C5H3F4N |
| Molecular Weight | 153.08 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | 2,3,5,6-tetrafluoro-1,2-dihydropyridine |
| SMILES | FC1=CC(F)=C(F)NC1F |
| InChI | InChI=1S/C5H3F4N/c6-2-1-3(7)5(9)10-4(2)8/h1,4,10H |
| InChIKey | ILGLHHGXBZAWCX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.08 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|