C7H11NO2 — CID 18619813
2,5-dimethoxy-1,2-dihydropyridine (PubChem CID 18619813) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 2,5-dimethoxy-1,2-dihydropyridine.
| Compound Name | 2,5-dimethoxy-1,2-dihydropyridine |
|---|---|
| PubChem CID | 18619813 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 2,5-dimethoxy-1,2-dihydropyridine |
| SMILES | COC1=CNC(OC)C=C1 |
| InChI | InChI=1S/C7H11NO2/c1-9-6-3-4-7(10-2)8-5-6/h3-5,7-8H,1-2H3 |
| InChIKey | SQCCGXPQVBNAFP-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |