About 2,6-dimethoxy-1,2-dihydropyridine
2,6-dimethoxy-1,2-dihydropyridine (PubChem CID 18619815) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 2,6-dimethoxy-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2,6-dimethoxy-1,2-dihydropyridine |
| PubChem CID | 18619815 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 2,6-dimethoxy-1,2-dihydropyridine |
| SMILES | COC1=CC=CC(OC)N1 |
| InChI | InChI=1S/C7H11NO2/c1-9-6-4-3-5-7(8-6)10-2/h3-6,8H,1-2H3 |
| InChIKey | RCDKCKITRRFWRE-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dimethoxy-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethoxy-1,2-dihydropyridine?
The IUPAC name of 2,6-dimethoxy-1,2-dihydropyridine (CID 18619815) is 2,6-dimethoxy-1,2-dihydropyridine.
What is the SMILES notation for 2,6-dimethoxy-1,2-dihydropyridine?
The canonical SMILES for 2,6-dimethoxy-1,2-dihydropyridine is COC1=CC=CC(OC)N1.
What is the InChIKey of 2,6-dimethoxy-1,2-dihydropyridine?
The InChIKey is RCDKCKITRRFWRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-9-6-4-3-5-7(8-6)10-2/h3-6,8H,1-2H3.
What are the key properties of 2,6-dimethoxy-1,2-dihydropyridine?
2,6-dimethoxy-1,2-dihydropyridine has a molecular weight of 141.17 g/mol, XLogP of 0.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethoxy-1,2-dihydropyridine is sourced from PubChem (CID 18619815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).