C12H22Cl2N4 — CID 18622046
1-[4-(2-aminoethyl)-2-methylphenyl]-2-ethylguanidine;dihydrochloride (PubChem CID 18622046) has the molecular formula C12H22Cl2N4 and a molecular weight of 293.24 g/mol. Its IUPAC name is 1-[4-(2-aminoethyl)-2-methylphenyl]-2-ethylguanidine;dihydrochloride.
| Compound Name | 1-[4-(2-aminoethyl)-2-methylphenyl]-2-ethylguanidine;dihydrochloride |
|---|---|
| PubChem CID | 18622046 |
| Molecular Formula | C12H22Cl2N4 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-[4-(2-aminoethyl)-2-methylphenyl]-2-ethylguanidine;dihydrochloride |
| SMILES | CC/N=C(\N)Nc1ccc(CCN)cc1C.Cl.Cl |
| InChI | InChI=1S/C12H20N4.2ClH/c1-3-15-12(14)16-11-5-4-10(6-7-13)8-9(11)2;;/h4-5,8H,3,6-7,13H2,1-2H3,(H3,14,15,16);2*1H |
| InChIKey | DIVCQWKVRZRAOL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|