C12H19N3O — CID 62871923
1-(4-methoxy-2-methylphenyl)-2-propylguanidine (PubChem CID 62871923) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-(4-methoxy-2-methylphenyl)-2-propylguanidine.
| Compound Name | 1-(4-methoxy-2-methylphenyl)-2-propylguanidine |
|---|---|
| PubChem CID | 62871923 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 1-(4-methoxy-2-methylphenyl)-2-propylguanidine |
| SMILES | CCC/N=C(\N)Nc1ccc(OC)cc1C |
| InChI | InChI=1S/C12H19N3O/c1-4-7-14-12(13)15-11-6-5-10(16-3)8-9(11)2/h5-6,8H,4,7H2,1-3H3,(H3,13,14,15) |
| InChIKey | CTWVMWNQIJXUII-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|