About bis(2-methylpropyl)alumanylium;propan-2-olate
bis(2-methylpropyl)alumanylium;propan-2-olate (PubChem CID 18622245) has the molecular formula C11H25AlO
and a molecular weight of 200.30 g/mol. Its IUPAC name is bis(2-methylpropyl)alumanylium;propan-2-olate.
Molecular Properties
| Compound Name | bis(2-methylpropyl)alumanylium;propan-2-olate |
| PubChem CID | 18622245 |
| Molecular Formula | C11H25AlO |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.17 |
| IUPAC Name | bis(2-methylpropyl)alumanylium;propan-2-olate |
| SMILES | CC(C)C[Al+]CC(C)C.CC(C)[O-] |
| InChI | InChI=1S/2C4H9.C3H7O.Al/c2*1-4(2)3;1-3(2)4;/h2*4H,1H2,2-3H3;3H,1-2H3;/q;;-1;+1 |
| InChIKey | YFNGCPVGPCKWAL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bis(2-methylpropyl)alumanylium;propan-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpropyl)alumanylium;propan-2-olate?
The IUPAC name of bis(2-methylpropyl)alumanylium;propan-2-olate (CID 18622245) is bis(2-methylpropyl)alumanylium;propan-2-olate.
What is the SMILES notation for bis(2-methylpropyl)alumanylium;propan-2-olate?
The canonical SMILES for bis(2-methylpropyl)alumanylium;propan-2-olate is CC(C)C[Al+]CC(C)C.CC(C)[O-].
What is the InChIKey of bis(2-methylpropyl)alumanylium;propan-2-olate?
The InChIKey is YFNGCPVGPCKWAL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H9.C3H7O.Al/c2*1-4(2)3;1-3(2)4;/h2*4H,1H2,2-3H3;3H,1-2H3;/q;;-1;+1.
What are the key properties of bis(2-methylpropyl)alumanylium;propan-2-olate?
bis(2-methylpropyl)alumanylium;propan-2-olate has a molecular weight of 200.30 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpropyl)alumanylium;propan-2-olate is sourced from PubChem (CID 18622245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).