C19H23FN2O5 — CID 18625664
ethyl 1-(2,2-diethoxyethyl)-2-(4-fluorophenyl)-6-oxopyrimidine-5-carboxylate (PubChem CID 18625664) has the molecular formula C19H23FN2O5 and a molecular weight of 378.40 g/mol. Its IUPAC name is ethyl 1-(2,2-diethoxyethyl)-2-(4-fluorophenyl)-6-oxopyrimidine-5-carboxylate.
| Compound Name | ethyl 1-(2,2-diethoxyethyl)-2-(4-fluorophenyl)-6-oxopyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 18625664 |
| Molecular Formula | C19H23FN2O5 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | ethyl 1-(2,2-diethoxyethyl)-2-(4-fluorophenyl)-6-oxopyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2ccc(F)cc2)n(CC(OCC)OCC)c1=O |
| InChI | InChI=1S/C19H23FN2O5/c1-4-25-16(26-5-2)12-22-17(13-7-9-14(20)10-8-13)21-11-15(18(22)23)19(24)27-6-3/h7-11,16H,4-6,12H2,1-3H3 |
| InChIKey | GKPDXXJCXQKEEK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|