C17H19FN2O5 — CID 18625660
1-(2,2-diethoxyethyl)-2-(4-fluorophenyl)-6-oxopyrimidine-5-carboxylic acid (PubChem CID 18625660) has the molecular formula C17H19FN2O5 and a molecular weight of 350.35 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-2-(4-fluorophenyl)-6-oxopyrimidine-5-carboxylic acid.
| Compound Name | 1-(2,2-diethoxyethyl)-2-(4-fluorophenyl)-6-oxopyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 18625660 |
| Molecular Formula | C17H19FN2O5 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-2-(4-fluorophenyl)-6-oxopyrimidine-5-carboxylic acid |
| SMILES | CCOC(Cn1c(-c2ccc(F)cc2)ncc(C(=O)O)c1=O)OCC |
| InChI | InChI=1S/C17H19FN2O5/c1-3-24-14(25-4-2)10-20-15(11-5-7-12(18)8-6-11)19-9-13(16(20)21)17(22)23/h5-9,14H,3-4,10H2,1-2H3,(H,22,23) |
| InChIKey | QSAWELCDQYHZGP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|