C26H23ClO4 — CID 18626569
ethyl 2-(4-chlorophenyl)-5-(9H-fluoren-9-yl)-1,3-dioxane-2-carboxylate (PubChem CID 18626569) has the molecular formula C26H23ClO4 and a molecular weight of 434.92 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenyl)-5-(9H-fluoren-9-yl)-1,3-dioxane-2-carboxylate.
| Compound Name | ethyl 2-(4-chlorophenyl)-5-(9H-fluoren-9-yl)-1,3-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 18626569 |
| Molecular Formula | C26H23ClO4 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | ethyl 2-(4-chlorophenyl)-5-(9H-fluoren-9-yl)-1,3-dioxane-2-carboxylate |
| SMILES | CCOC(=O)C1(c2ccc(Cl)cc2)OCC(C2c3ccccc3-c3ccccc32)CO1 |
| InChI | InChI=1S/C26H23ClO4/c1-2-29-25(28)26(18-11-13-19(27)14-12-18)30-15-17(16-31-26)24-22-9-5-3-7-20(22)21-8-4-6-10-23(21)24/h3-14,17,24H,2,15-16H2,1H3 |
| InChIKey | LMLHLDJDOUFZDT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |