C22H27Cl2N3O6 — CID 18633435
5-(2,6-dichlorophenoxy)-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]pentanamide (PubChem CID 18633435) has the molecular formula C22H27Cl2N3O6 and a molecular weight of 500.38 g/mol. Its IUPAC name is 5-(2,6-dichlorophenoxy)-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]pentanamide.
| Compound Name | 5-(2,6-dichlorophenoxy)-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]pentanamide |
|---|---|
| PubChem CID | 18633435 |
| Molecular Formula | C22H27Cl2N3O6 |
| Molecular Weight | 500.38 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 5-(2,6-dichlorophenoxy)-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]pentanamide |
| SMILES | CCc1cn([C@H]2C[C@H](O)[C@@H](CNC(=O)CCCCOc3c(Cl)cccc3Cl)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H27Cl2N3O6/c1-2-13-12-27(22(31)26-21(13)30)19-10-16(28)17(33-19)11-25-18(29)8-3-4-9-32-20-14(23)6-5-7-15(20)24/h5-7,12,16-17,19,28H,2-4,8-11H2,1H3,(H,25,29)(H,26,30,31)/t16-,17+,19+/m0/s1 |
| InChIKey | LAAWVODTELEHAB-YQVWRLOYSA-N |
| XLogP | 2.42 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|