C34H56Cl2O — CID 18633481
3,11-bis(4-butylcyclohexyl)-14,14-dichlorodispiro[5.1.58.16]tetradecan-7-one (PubChem CID 18633481) has the molecular formula C34H56Cl2O and a molecular weight of 551.73 g/mol. Its IUPAC name is 3,11-bis(4-butylcyclohexyl)-14,14-dichlorodispiro[5.1.58.16]tetradecan-7-one.
| Compound Name | 3,11-bis(4-butylcyclohexyl)-14,14-dichlorodispiro[5.1.58.16]tetradecan-7-one |
|---|---|
| PubChem CID | 18633481 |
| Molecular Formula | C34H56Cl2O |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | 3,11-bis(4-butylcyclohexyl)-14,14-dichlorodispiro[5.1.58.16]tetradecan-7-one |
| SMILES | CCCCC1CCC(C2CCC3(CC2)C(=O)C2(CCC(C4CCC(CCCC)CC4)CC2)C3(Cl)Cl)CC1 |
| InChI | InChI=1S/C34H56Cl2O/c1-3-5-7-25-9-13-27(14-10-25)29-17-21-32(22-18-29)31(37)33(34(32,35)36)23-19-30(20-24-33)28-15-11-26(12-16-28)8-6-4-2/h25-30H,3-24H2,1-2H3 |
| InChIKey | QAPQIQHIORZASY-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|