C25H42O3 — CID 70371252
trans-methyl (1S,4R)-4-[4-(4-butylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate (PubChem CID 70371252) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is trans-methyl (1S,4R)-4-[4-(4-butylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate.
| Compound Name | trans-methyl (1S,4R)-4-[4-(4-butylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70371252 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | trans-methyl (1S,4R)-4-[4-(4-butylcyclohexyl)cyclohexyl]-1-methyl-2-oxocyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C2CCC([C@@H]3CC[C@](C)(C(=O)OC)C(=O)C3)CC2)CC1 |
| InChI | InChI=1S/C25H42O3/c1-4-5-6-18-7-9-19(10-8-18)20-11-13-21(14-12-20)22-15-16-25(2,23(26)17-22)24(27)28-3/h18-22H,4-17H2,1-3H3/t18?,19?,20?,21?,22-,25+/m1/s1 |
| InChIKey | LWTYDIBIZKHEBV-PLWAQTSVSA-N |
| XLogP | 6.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|