C24H40O3 — CID 70371560
methyl (1S)-1-methyl-2-oxo-4-[4-(4-propylcyclohexyl)cyclohexyl]cyclohexane-1-carboxylate (PubChem CID 70371560) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is methyl (1S)-1-methyl-2-oxo-4-[4-(4-propylcyclohexyl)cyclohexyl]cyclohexane-1-carboxylate.
| Compound Name | methyl (1S)-1-methyl-2-oxo-4-[4-(4-propylcyclohexyl)cyclohexyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70371560 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | methyl (1S)-1-methyl-2-oxo-4-[4-(4-propylcyclohexyl)cyclohexyl]cyclohexane-1-carboxylate |
| SMILES | CCCC1CCC(C2CCC(C3CC[C@](C)(C(=O)OC)C(=O)C3)CC2)CC1 |
| InChI | InChI=1S/C24H40O3/c1-4-5-17-6-8-18(9-7-17)19-10-12-20(13-11-19)21-14-15-24(2,22(25)16-21)23(26)27-3/h17-21H,4-16H2,1-3H3/t17?,18?,19?,20?,21?,24-/m0/s1 |
| InChIKey | DRGVEZGNJTVPHZ-GFCDBYRKSA-N |
| XLogP | 5.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|