C32H44N2O6 — CID 18634492
[(1S,3R,7S,8S,8aR)-3-[1-(carbamoylamino)-2-phenylethyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 18634492) has the molecular formula C32H44N2O6 and a molecular weight of 552.71 g/mol. Its IUPAC name is [(1S,3R,7S,8S,8aR)-3-[1-(carbamoylamino)-2-phenylethyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [(1S,3R,7S,8S,8aR)-3-[1-(carbamoylamino)-2-phenylethyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 18634492 |
| Molecular Formula | C32H44N2O6 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-3-[1-(carbamoylamino)-2-phenylethyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)O[C@H]1C[C@@H](C(Cc2ccccc2)NC(N)=O)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C32H44N2O6/c1-4-19(2)31(37)40-28-16-23(27(34-32(33)38)14-21-8-6-5-7-9-21)15-22-11-10-20(3)26(30(22)28)13-12-25-17-24(35)18-29(36)39-25/h5-11,15,19-20,23-28,30,35H,4,12-14,16-18H2,1-3H3,(H3,33,34,38)/t19?,20-,23-,24+,25+,26-,27?,28-,30-/m0/s1 |
| InChIKey | ULFDGVWTKXASEN-HRIHAWCKSA-N |
| XLogP | 4.46 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |