C33H46N2O6 — CID 67895497
[(1S,3R,7S,8S,8aR)-3-[1-(carbamoylamino)-2-phenylethyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 67895497) has the molecular formula C33H46N2O6 and a molecular weight of 566.74 g/mol. Its IUPAC name is [(1S,3R,7S,8S,8aR)-3-[1-(carbamoylamino)-2-phenylethyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,3R,7S,8S,8aR)-3-[1-(carbamoylamino)-2-phenylethyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 67895497 |
| Molecular Formula | C33H46N2O6 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-3-[1-(carbamoylamino)-2-phenylethyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@H]1C[C@@H](C(Cc2ccccc2)NC(N)=O)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C33H46N2O6/c1-5-33(3,4)31(38)41-28-17-23(27(35-32(34)39)15-21-9-7-6-8-10-21)16-22-12-11-20(2)26(30(22)28)14-13-25-18-24(36)19-29(37)40-25/h6-12,16,20,23-28,30,36H,5,13-15,17-19H2,1-4H3,(H3,34,35,39)/t20-,23-,24+,25+,26-,27?,28-,30-/m0/s1 |
| InChIKey | FHPHQFYCOZPHIM-VTFDYEGDSA-N |
| XLogP | 4.85 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |