C24H43FO5 — CID 18638685
ethyl 7-[(5R,6S,7aR)-2-ethoxy-2-(1-fluoropentyl)-6-hydroxy-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[b]pyran-5-yl]heptanoate (PubChem CID 18638685) has the molecular formula C24H43FO5 and a molecular weight of 430.60 g/mol. Its IUPAC name is ethyl 7-[(5R,6S,7aR)-2-ethoxy-2-(1-fluoropentyl)-6-hydroxy-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[b]pyran-5-yl]heptanoate.
| Compound Name | ethyl 7-[(5R,6S,7aR)-2-ethoxy-2-(1-fluoropentyl)-6-hydroxy-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[b]pyran-5-yl]heptanoate |
|---|---|
| PubChem CID | 18638685 |
| Molecular Formula | C24H43FO5 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | ethyl 7-[(5R,6S,7aR)-2-ethoxy-2-(1-fluoropentyl)-6-hydroxy-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[b]pyran-5-yl]heptanoate |
| SMILES | CCCCC(F)C1(OCC)CCC2[C@@H](CCCCCCC(=O)OCC)[C@@H](O)C[C@H]2O1 |
| InChI | InChI=1S/C24H43FO5/c1-4-7-13-22(25)24(29-6-3)16-15-19-18(20(26)17-21(19)30-24)12-10-8-9-11-14-23(27)28-5-2/h18-22,26H,4-17H2,1-3H3/t18-,19?,20+,21-,22?,24?/m1/s1 |
| InChIKey | DMGKDWDZVFNSBM-SYHMMHJISA-N |
| XLogP | 5.33 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|