C30H42O6 — CID 18639639
(2S,4aS,6aS,6aS,6bR,10R,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-11,12,13-trioxo-3,4,5,6,6a,7,8,8a,10,14b-decahydro-1H-picene-2-carboxylic acid (PubChem CID 18639639) has the molecular formula C30H42O6 and a molecular weight of 498.66 g/mol. Its IUPAC name is (2S,4aS,6aS,6aS,6bR,10R,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-11,12,13-trioxo-3,4,5,6,6a,7,8,8a,10,14b-decahydro-1H-picene-2-carboxylic acid.
| Compound Name | (2S,4aS,6aS,6aS,6bR,10R,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-11,12,13-trioxo-3,4,5,6,6a,7,8,8a,10,14b-decahydro-1H-picene-2-carboxylic acid |
|---|---|
| PubChem CID | 18639639 |
| Molecular Formula | C30H42O6 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | (2S,4aS,6aS,6aS,6bR,10R,12aS,14bS)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-11,12,13-trioxo-3,4,5,6,6a,7,8,8a,10,14b-decahydro-1H-picene-2-carboxylic acid |
| SMILES | CC1(C)C2CC[C@]3(C)[C@H](C(=O)C=C4[C@H]5C[C@@](C)(C(=O)O)CC[C@]5(C)CC[C@]43C)[C@@]2(C)C(=O)C(=O)[C@@H]1O |
| InChI | InChI=1S/C30H42O6/c1-25(2)19-8-9-29(6)21(30(19,7)23(34)20(32)22(25)33)18(31)14-16-17-15-27(4,24(35)36)11-10-26(17,3)12-13-28(16,29)5/h14,17,19,21-22,33H,8-13,15H2,1-7H3,(H,35,36)/t17-,19?,21+,22+,26-,27+,28-,29-,30+/m1/s1 |
| InChIKey | AFOKKJFZAMUOGO-PBMADIAASA-N |
| XLogP | 4.77 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|