C30H44O5 — CID 25028810
(1R,2S,5S,8S,15S,16R,17R,19S)-16-hydroxy-1,2,5,8,15,20,20-heptamethyl-13-oxo-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricos-11-ene-8-carboxylic acid (PubChem CID 25028810) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is (1R,2S,5S,8S,15S,16R,17R,19S)-16-hydroxy-1,2,5,8,15,20,20-heptamethyl-13-oxo-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricos-11-ene-8-carboxylic acid.
| Compound Name | (1R,2S,5S,8S,15S,16R,17R,19S)-16-hydroxy-1,2,5,8,15,20,20-heptamethyl-13-oxo-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricos-11-ene-8-carboxylic acid |
|---|---|
| PubChem CID | 25028810 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (1R,2S,5S,8S,15S,16R,17R,19S)-16-hydroxy-1,2,5,8,15,20,20-heptamethyl-13-oxo-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricos-11-ene-8-carboxylic acid |
| SMILES | CC1(C)C2CC[C@]3(C)C(C(=O)C=C4C5C[C@@](C)(C(=O)O)CC[C@]5(C)CC[C@]43C)[C@@]2(C)[C@@H](O)[C@H]2O[C@H]21 |
| InChI | InChI=1S/C30H44O5/c1-25(2)19-8-9-29(6)21(30(19,7)22(32)20-23(25)35-20)18(31)14-16-17-15-27(4,24(33)34)11-10-26(17,3)12-13-28(16,29)5/h14,17,19-23,32H,8-13,15H2,1-7H3,(H,33,34)/t17?,19?,20-,21?,22+,23-,26-,27+,28-,29-,30+/m1/s1 |
| InChIKey | DUVJRGZOEIKAEO-VQXWODOYSA-N |
| XLogP | 5.40 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|