C7H13NO4 — CID 18640525
(2S,4R)-4-(dimethoxymethyl)azetidine-2-carboxylic acid (PubChem CID 18640525) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is (2S,4R)-4-(dimethoxymethyl)azetidine-2-carboxylic acid.
| Compound Name | (2S,4R)-4-(dimethoxymethyl)azetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18640525 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (2S,4R)-4-(dimethoxymethyl)azetidine-2-carboxylic acid |
| SMILES | COC(OC)[C@H]1C[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C7H13NO4/c1-11-7(12-2)5-3-4(8-5)6(9)10/h4-5,7-8H,3H2,1-2H3,(H,9,10)/t4-,5+/m0/s1 |
| InChIKey | XGMUICKARASZSI-CRCLSJGQSA-N |
| XLogP | -0.58 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|