C9H17NO3 — CID 112575064
5-(1-methoxypropan-2-yl)pyrrolidine-2-carboxylic acid (PubChem CID 112575064) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 5-(1-methoxypropan-2-yl)pyrrolidine-2-carboxylic acid.
| Compound Name | 5-(1-methoxypropan-2-yl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 112575064 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 5-(1-methoxypropan-2-yl)pyrrolidine-2-carboxylic acid |
| SMILES | COCC(C)C1CCC(C(=O)O)N1 |
| InChI | InChI=1S/C9H17NO3/c1-6(5-13-2)7-3-4-8(10-7)9(11)12/h6-8,10H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | HTGZXQXETFRFNT-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |