C9H14N2O3 — CID 59911159
(2R,5R)-5-[1-(ethynoxyamino)ethyl]pyrrolidine-2-carboxylic acid (PubChem CID 59911159) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is (2R,5R)-5-[1-(ethynoxyamino)ethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,5R)-5-[1-(ethynoxyamino)ethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 59911159 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | (2R,5R)-5-[1-(ethynoxyamino)ethyl]pyrrolidine-2-carboxylic acid |
| SMILES | C#CONC(C)[C@H]1CC[C@H](C(=O)O)N1 |
| InChI | InChI=1S/C9H14N2O3/c1-3-14-11-6(2)7-4-5-8(10-7)9(12)13/h1,6-8,10-11H,4-5H2,2H3,(H,12,13)/t6?,7-,8-/m1/s1 |
| InChIKey | VBOJAIHSYIRSBY-SPDVFEMOSA-N |
| XLogP | -0.31 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|