C11H19N3O2 — CID 23384662
1-[4-amino-5-[1-(ethynoxyamino)ethyl]-1-methylpyrrolidin-2-yl]ethanone (PubChem CID 23384662) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-[4-amino-5-[1-(ethynoxyamino)ethyl]-1-methylpyrrolidin-2-yl]ethanone.
| Compound Name | 1-[4-amino-5-[1-(ethynoxyamino)ethyl]-1-methylpyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 23384662 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1-[4-amino-5-[1-(ethynoxyamino)ethyl]-1-methylpyrrolidin-2-yl]ethanone |
| SMILES | C#CONC(C)C1C(N)CC(C(C)=O)N1C |
| InChI | InChI=1S/C11H19N3O2/c1-5-16-13-7(2)11-9(12)6-10(8(3)15)14(11)4/h1,7,9-11,13H,6,12H2,2-4H3 |
| InChIKey | KPVRIHLWJHFXSF-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|