C14H27AcN2O4- — CID 59910969
[1-[(2R,3R,5R)-5-acetyl-3-(1-ethoxyethoxymethyl)-1-methylpyrrolidin-2-yl]-2-hydroxyethyl]azanide;actinium (PubChem CID 59910969) has the molecular formula C14H27AcN2O4- and a molecular weight of 514.38 g/mol. Its IUPAC name is [1-[(2R,3R,5R)-5-acetyl-3-(1-ethoxyethoxymethyl)-1-methylpyrrolidin-2-yl]-2-hydroxyethyl]azanide;actinium.
| Compound Name | [1-[(2R,3R,5R)-5-acetyl-3-(1-ethoxyethoxymethyl)-1-methylpyrrolidin-2-yl]-2-hydroxyethyl]azanide;actinium |
|---|---|
| PubChem CID | 59910969 |
| Molecular Formula | C14H27AcN2O4- |
| Molecular Weight | 514.38 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | [1-[(2R,3R,5R)-5-acetyl-3-(1-ethoxyethoxymethyl)-1-methylpyrrolidin-2-yl]-2-hydroxyethyl]azanide;actinium |
| SMILES | CCOC(C)OC[C@@H]1C[C@H](C(C)=O)N(C)[C@H]1C([NH-])CO.[Ac] |
| InChI | InChI=1S/C14H27N2O4.Ac/c1-5-19-10(3)20-8-11-6-13(9(2)18)16(4)14(11)12(15)7-17;/h10-15,17H,5-8H2,1-4H3;/q-1;/t10?,11-,12?,13+,14+;/m0./s1 |
| InChIKey | KKJAUTWKTIQTRK-RTKXAFSKSA-N |
| XLogP | 1.08 |
| TPSA | 82.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|