C18H34N2O4 — CID 59911183
1-[(2R,4S)-5-[1-amino-3-(1-ethoxyethoxy)-2-hydroxy-2-methylpropyl]-1-methyl-4-[(Z)-prop-1-enyl]pyrrolidin-2-yl]ethanone (PubChem CID 59911183) has the molecular formula C18H34N2O4 and a molecular weight of 342.48 g/mol. Its IUPAC name is 1-[(2R,4S)-5-[1-amino-3-(1-ethoxyethoxy)-2-hydroxy-2-methylpropyl]-1-methyl-4-[(Z)-prop-1-enyl]pyrrolidin-2-yl]ethanone.
| Compound Name | 1-[(2R,4S)-5-[1-amino-3-(1-ethoxyethoxy)-2-hydroxy-2-methylpropyl]-1-methyl-4-[(Z)-prop-1-enyl]pyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 59911183 |
| Molecular Formula | C18H34N2O4 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | 1-[(2R,4S)-5-[1-amino-3-(1-ethoxyethoxy)-2-hydroxy-2-methylpropyl]-1-methyl-4-[(Z)-prop-1-enyl]pyrrolidin-2-yl]ethanone |
| SMILES | C/C=C\[C@@H]1C[C@H](C(C)=O)N(C)C1C(N)C(C)(O)COC(C)OCC |
| InChI | InChI=1S/C18H34N2O4/c1-7-9-14-10-15(12(3)21)20(6)16(14)17(19)18(5,22)11-24-13(4)23-8-2/h7,9,13-17,22H,8,10-11,19H2,1-6H3/b9-7-/t13?,14-,15-,16?,17?,18?/m1/s1 |
| InChIKey | LWVKSXPWZFSYLE-REKBRLDHSA-N |
| XLogP | 1.32 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|