C15H28FN3O5 — CID 142672817
tert-butyl (2R,4S)-2-[(2Z)-2-amino-1-(1-ethoxyethoxy)-2-hydroxyiminoethyl]-4-fluoropyrrolidine-1-carboxylate (PubChem CID 142672817) has the molecular formula C15H28FN3O5 and a molecular weight of 349.40 g/mol. Its IUPAC name is tert-butyl (2R,4S)-2-[(2Z)-2-amino-1-(1-ethoxyethoxy)-2-hydroxyiminoethyl]-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-2-[(2Z)-2-amino-1-(1-ethoxyethoxy)-2-hydroxyiminoethyl]-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142672817 |
| Molecular Formula | C15H28FN3O5 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | tert-butyl (2R,4S)-2-[(2Z)-2-amino-1-(1-ethoxyethoxy)-2-hydroxyiminoethyl]-4-fluoropyrrolidine-1-carboxylate |
| SMILES | CCOC(C)OC(/C(N)=N/O)[C@H]1C[C@H](F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28FN3O5/c1-6-22-9(2)23-12(13(17)18-21)11-7-10(16)8-19(11)14(20)24-15(3,4)5/h9-12,21H,6-8H2,1-5H3,(H2,17,18)/t9?,10-,11+,12?/m0/s1 |
| InChIKey | RPDZYFHUGVYTSU-LVFLEHKBSA-N |
| XLogP | 1.85 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|