C15H25FN2O4 — CID 90821226
tert-butyl (2R,4S)-2-[cyano(1-ethoxyethoxy)methyl]-4-fluoropyrrolidine-1-carboxylate (PubChem CID 90821226) has the molecular formula C15H25FN2O4 and a molecular weight of 316.37 g/mol. Its IUPAC name is tert-butyl (2R,4S)-2-[cyano(1-ethoxyethoxy)methyl]-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-2-[cyano(1-ethoxyethoxy)methyl]-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90821226 |
| Molecular Formula | C15H25FN2O4 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | tert-butyl (2R,4S)-2-[cyano(1-ethoxyethoxy)methyl]-4-fluoropyrrolidine-1-carboxylate |
| SMILES | CCOC(C)OC(C#N)[C@H]1C[C@H](F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25FN2O4/c1-6-20-10(2)21-13(8-17)12-7-11(16)9-18(12)14(19)22-15(3,4)5/h10-13H,6-7,9H2,1-5H3/t10?,11-,12+,13?/m0/s1 |
| InChIKey | UJHCTYRYCHVJDN-CMOBGSAGSA-N |
| XLogP | 2.63 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|