C11H16N2O4 — CID 59911178
(2R,4R,5R)-4-acetyl-5-[1-(ethynoxyamino)ethyl]pyrrolidine-2-carboxylic acid (PubChem CID 59911178) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is (2R,4R,5R)-4-acetyl-5-[1-(ethynoxyamino)ethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4R,5R)-4-acetyl-5-[1-(ethynoxyamino)ethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 59911178 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (2R,4R,5R)-4-acetyl-5-[1-(ethynoxyamino)ethyl]pyrrolidine-2-carboxylic acid |
| SMILES | C#CONC(C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1C(C)=O |
| InChI | InChI=1S/C11H16N2O4/c1-4-17-13-6(2)10-8(7(3)14)5-9(12-10)11(15)16/h1,6,8-10,12-13H,5H2,2-3H3,(H,15,16)/t6?,8-,9+,10-/m0/s1 |
| InChIKey | YVSMVQZNBYJBIA-KQLRBDFZSA-N |
| XLogP | -0.49 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|