C33H27Cl3N4O3S3 — CID 18640704
benzhydryl (6S,7R)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-7-[(2,2,3-trichloro-3-phenylpropylidene)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 18640704) has the molecular formula C33H27Cl3N4O3S3 and a molecular weight of 730.16 g/mol. Its IUPAC name is benzhydryl (6S,7R)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-7-[(2,2,3-trichloro-3-phenylpropylidene)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6S,7R)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-7-[(2,2,3-trichloro-3-phenylpropylidene)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 18640704 |
| Molecular Formula | C33H27Cl3N4O3S3 |
| Molecular Weight | 730.16 g/mol |
| Exact Mass | 728.03 |
| IUPAC Name | benzhydryl (6S,7R)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-7-[(2,2,3-trichloro-3-phenylpropylidene)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | Cc1nnc(SCC2=C(C(=O)OC(c3ccccc3)c3ccccc3)N3C(=O)[C@@H](/N=C/C(Cl)(Cl)C(Cl)c4ccccc4)[C@@H]3SC2)s1 |
| InChI | InChI=1S/C33H27Cl3N4O3S3/c1-20-38-39-32(46-20)45-18-24-17-44-30-25(37-19-33(35,36)28(34)23-15-9-4-10-16-23)29(41)40(30)26(24)31(42)43-27(21-11-5-2-6-12-21)22-13-7-3-8-14-22/h2-16,19,25,27-28,30H,17-18H2,1H3/b37-19+/t25-,28?,30+/m1/s1 |
| InChIKey | RCLIPNAZRPHGRU-MHYCGOFKSA-N |
| XLogP | 8.03 |
| TPSA | 84.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.16 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|