C28H24N2O5S — CID 91569557
benzhydryl (6S)-7-(benzylideneamino)-3-(hydroperoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 91569557) has the molecular formula C28H24N2O5S and a molecular weight of 500.58 g/mol. Its IUPAC name is benzhydryl (6S)-7-(benzylideneamino)-3-(hydroperoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6S)-7-(benzylideneamino)-3-(hydroperoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 91569557 |
| Molecular Formula | C28H24N2O5S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | benzhydryl (6S)-7-(benzylideneamino)-3-(hydroperoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)C1=C(COO)CS[C@H]2C(/N=C/c3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C28H24N2O5S/c31-26-23(29-16-19-10-4-1-5-11-19)27-30(26)24(22(17-34-33)18-36-27)28(32)35-25(20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-16,23,25,27,33H,17-18H2/b29-16+/t23?,27-/m0/s1 |
| InChIKey | WVLWWWALXYDRPN-ZHSFNUDVSA-N |
| XLogP | 4.47 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|