C25H30ClN3O — CID 18641103
(8aR,12aS,13aS)-N-chloro-N-[(1R)-1-phenylethyl]-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine-4-carboxamide (PubChem CID 18641103) has the molecular formula C25H30ClN3O and a molecular weight of 423.99 g/mol. Its IUPAC name is (8aR,12aS,13aS)-N-chloro-N-[(1R)-1-phenylethyl]-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine-4-carboxamide.
| Compound Name | (8aR,12aS,13aS)-N-chloro-N-[(1R)-1-phenylethyl]-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine-4-carboxamide |
|---|---|
| PubChem CID | 18641103 |
| Molecular Formula | C25H30ClN3O |
| Molecular Weight | 423.99 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | (8aR,12aS,13aS)-N-chloro-N-[(1R)-1-phenylethyl]-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine-4-carboxamide |
| SMILES | C[C@H](c1ccccc1)N(Cl)C(=O)c1cccc2c1CCN1C[C@H]3CCCN[C@H]3C[C@@H]21 |
| InChI | InChI=1S/C25H30ClN3O/c1-17(18-7-3-2-4-8-18)29(26)25(30)22-11-5-10-21-20(22)12-14-28-16-19-9-6-13-27-23(19)15-24(21)28/h2-5,7-8,10-11,17,19,23-24,27H,6,9,12-16H2,1H3/t17-,19-,23+,24+/m1/s1 |
| InChIKey | FCCNFNQTUVLDFM-DQHAIFDPSA-N |
| XLogP | 4.71 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.99 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|