C26H31N3O3 — CID 88606523
N-hydroxy-N-[(1S)-1-hydroxy-1-phenylprop-2-enyl]-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine-1-carboxamide (PubChem CID 88606523) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is N-hydroxy-N-[(1S)-1-hydroxy-1-phenylprop-2-enyl]-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine-1-carboxamide.
| Compound Name | N-hydroxy-N-[(1S)-1-hydroxy-1-phenylprop-2-enyl]-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 88606523 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | N-hydroxy-N-[(1S)-1-hydroxy-1-phenylprop-2-enyl]-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-g][1,6]naphthyridine-1-carboxamide |
| SMILES | C=C[C@](O)(c1ccccc1)N(O)C(=O)c1cccc2c1C1CC3NCCCC3CN1CC2 |
| InChI | InChI=1S/C26H31N3O3/c1-2-26(31,20-10-4-3-5-11-20)29(32)25(30)21-12-6-8-18-13-15-28-17-19-9-7-14-27-22(19)16-23(28)24(18)21/h2-6,8,10-12,19,22-23,27,31-32H,1,7,9,13-17H2/t19?,22?,23?,26-/m0/s1 |
| InChIKey | STTUPZOECBRVLJ-LTFFKKTDSA-N |
| XLogP | 3.22 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|