C28H49N — CID 18643211
trans-(1R,2S)-2-[4-(4-ethylcyclohexyl)cyclohexyl]-1-heptylcyclohexane-1-carbonitrile (PubChem CID 18643211) has the molecular formula C28H49N and a molecular weight of 399.71 g/mol. Its IUPAC name is trans-(1R,2S)-2-[4-(4-ethylcyclohexyl)cyclohexyl]-1-heptylcyclohexane-1-carbonitrile.
| Compound Name | trans-(1R,2S)-2-[4-(4-ethylcyclohexyl)cyclohexyl]-1-heptylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 18643211 |
| Molecular Formula | C28H49N |
| Molecular Weight | 399.71 g/mol |
| Exact Mass | 399.39 |
| IUPAC Name | trans-(1R,2S)-2-[4-(4-ethylcyclohexyl)cyclohexyl]-1-heptylcyclohexane-1-carbonitrile |
| SMILES | CCCCCCC[C@@]1(C#N)CCCC[C@H]1C1CCC(C2CCC(CC)CC2)CC1 |
| InChI | InChI=1S/C28H49N/c1-3-5-6-7-9-20-28(22-29)21-10-8-11-27(28)26-18-16-25(17-19-26)24-14-12-23(4-2)13-15-24/h23-27H,3-21H2,1-2H3/t23?,24?,25?,26?,27-,28-/m0/s1 |
| InChIKey | MHAKNSZAEYIDES-RNWILARYSA-N |
| XLogP | 9.07 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.71 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|