C28H39ClO7 — CID 18644058
chloromethyl (8S,9S,10R,11S,13S,14S,17R)-17-cyclohexyloxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 18644058) has the molecular formula C28H39ClO7 and a molecular weight of 523.07 g/mol. Its IUPAC name is chloromethyl (8S,9S,10R,11S,13S,14S,17R)-17-cyclohexyloxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | chloromethyl (8S,9S,10R,11S,13S,14S,17R)-17-cyclohexyloxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 18644058 |
| Molecular Formula | C28H39ClO7 |
| Molecular Weight | 523.07 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | chloromethyl (8S,9S,10R,11S,13S,14S,17R)-17-cyclohexyloxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@]2(OC(=O)OC1CCCCC1)C(=O)OCCl |
| InChI | InChI=1S/C28H39ClO7/c1-26-12-10-18(30)14-17(26)8-9-20-21-11-13-28(24(32)34-16-29,27(21,2)15-22(31)23(20)26)36-25(33)35-19-6-4-3-5-7-19/h14,19-23,31H,3-13,15-16H2,1-2H3/t20-,21-,22-,23+,26-,27-,28-/m0/s1 |
| InChIKey | GTRWTNNAEDUCIY-ASWVGCLASA-N |
| XLogP | 5.45 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.07 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|